C19H27FN2OS — CID 90630390
N-cycloheptyl-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90630390) has the molecular formula C19H27FN2OS and a molecular weight of 350.50 g/mol. Its IUPAC name is N-cycloheptyl-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-cycloheptyl-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90630390 |
| Molecular Formula | C19H27FN2OS |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-cycloheptyl-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)N1CCSC(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN2OS/c20-17-10-6-5-9-16(17)18-11-12-22(13-14-24-18)19(23)21-15-7-3-1-2-4-8-15/h5-6,9-10,15,18H,1-4,7-8,11-14H2,(H,21,23) |
| InChIKey | RQJQXSYPMUFANL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |