C16H16FNOS2 — CID 90630207
[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-thiophen-3-ylmethanone (PubChem CID 90630207) has the molecular formula C16H16FNOS2 and a molecular weight of 321.44 g/mol. Its IUPAC name is [7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-thiophen-3-ylmethanone.
| Compound Name | [7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 90630207 |
| Molecular Formula | C16H16FNOS2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | [7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCSC(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H16FNOS2/c17-14-4-2-1-3-13(14)15-5-7-18(8-10-21-15)16(19)12-6-9-20-11-12/h1-4,6,9,11,15H,5,7-8,10H2 |
| InChIKey | AQOXFZZUQWTIAY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |