C20H20FNO3S — CID 90630249
[4-[7-(2-fluorophenyl)-1,4-thiazepane-4-carbonyl]phenyl] acetate (PubChem CID 90630249) has the molecular formula C20H20FNO3S and a molecular weight of 373.45 g/mol. Its IUPAC name is [4-[7-(2-fluorophenyl)-1,4-thiazepane-4-carbonyl]phenyl] acetate.
| Compound Name | [4-[7-(2-fluorophenyl)-1,4-thiazepane-4-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 90630249 |
| Molecular Formula | C20H20FNO3S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [4-[7-(2-fluorophenyl)-1,4-thiazepane-4-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N2CCSC(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H20FNO3S/c1-14(23)25-16-8-6-15(7-9-16)20(24)22-11-10-19(26-13-12-22)17-4-2-3-5-18(17)21/h2-9,19H,10-13H2,1H3 |
| InChIKey | QYLOZSQCUVUGOX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|