C20H21F2NO2S — CID 90631641
[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(4-ethoxyphenyl)methanone (PubChem CID 90631641) has the molecular formula C20H21F2NO2S and a molecular weight of 377.46 g/mol. Its IUPAC name is [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(4-ethoxyphenyl)methanone.
| Compound Name | [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90631641 |
| Molecular Formula | C20H21F2NO2S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)N2CCSC(c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H21F2NO2S/c1-2-25-16-6-3-14(4-7-16)20(24)23-10-9-19(26-12-11-23)17-13-15(21)5-8-18(17)22/h3-8,13,19H,2,9-12H2,1H3 |
| InChIKey | GHUTVXBJTUQPBU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |