C17H16F2N2OS — CID 90631750
[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-pyridin-2-ylmethanone (PubChem CID 90631750) has the molecular formula C17H16F2N2OS and a molecular weight of 334.39 g/mol. Its IUPAC name is [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-pyridin-2-ylmethanone.
| Compound Name | [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 90631750 |
| Molecular Formula | C17H16F2N2OS |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H16F2N2OS/c18-12-4-5-14(19)13(11-12)16-6-8-21(9-10-23-16)17(22)15-3-1-2-7-20-15/h1-5,7,11,16H,6,8-10H2 |
| InChIKey | FWOVYFDOCBANCO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |