C17H22F2N2OS — CID 90631925
N-cyclopentyl-7-(2,5-difluorophenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90631925) has the molecular formula C17H22F2N2OS and a molecular weight of 340.44 g/mol. Its IUPAC name is N-cyclopentyl-7-(2,5-difluorophenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-cyclopentyl-7-(2,5-difluorophenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90631925 |
| Molecular Formula | C17H22F2N2OS |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-cyclopentyl-7-(2,5-difluorophenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H22F2N2OS/c18-12-5-6-15(19)14(11-12)16-7-8-21(9-10-23-16)17(22)20-13-3-1-2-4-13/h5-6,11,13,16H,1-4,7-10H2,(H,20,22) |
| InChIKey | PZXYDKYJUUIPHA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |