C21H24F2N2OS — CID 90631920
7-(2,5-difluorophenyl)-N-(3-phenylpropyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90631920) has the molecular formula C21H24F2N2OS and a molecular weight of 390.50 g/mol. Its IUPAC name is 7-(2,5-difluorophenyl)-N-(3-phenylpropyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(2,5-difluorophenyl)-N-(3-phenylpropyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90631920 |
| Molecular Formula | C21H24F2N2OS |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 7-(2,5-difluorophenyl)-N-(3-phenylpropyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H24F2N2OS/c22-17-8-9-19(23)18(15-17)20-10-12-25(13-14-27-20)21(26)24-11-4-7-16-5-2-1-3-6-16/h1-3,5-6,8-9,15,20H,4,7,10-14H2,(H,24,26) |
| InChIKey | NMJMFMRTOJPICK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|