C16H16F2N2OS2 — CID 90631895
7-(2,5-difluorophenyl)-N-thiophen-2-yl-1,4-thiazepane-4-carboxamide (PubChem CID 90631895) has the molecular formula C16H16F2N2OS2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 7-(2,5-difluorophenyl)-N-thiophen-2-yl-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(2,5-difluorophenyl)-N-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90631895 |
| Molecular Formula | C16H16F2N2OS2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 7-(2,5-difluorophenyl)-N-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(Nc1cccs1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H16F2N2OS2/c17-11-3-4-13(18)12(10-11)14-5-6-20(7-9-22-14)16(21)19-15-2-1-8-23-15/h1-4,8,10,14H,5-7,9H2,(H,19,21) |
| InChIKey | ALJLFYOPBMUKCW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |