C19H25F2NOS — CID 90631618
2-cyclohexyl-1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]ethanone (PubChem CID 90631618) has the molecular formula C19H25F2NOS and a molecular weight of 353.48 g/mol. Its IUPAC name is 2-cyclohexyl-1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]ethanone |
|---|---|
| PubChem CID | 90631618 |
| Molecular Formula | C19H25F2NOS |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-cyclohexyl-1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C19H25F2NOS/c20-15-6-7-17(21)16(13-15)18-8-9-22(10-11-24-18)19(23)12-14-4-2-1-3-5-14/h6-7,13-14,18H,1-5,8-12H2 |
| InChIKey | DYSQGVYOLZIFSX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |