C19H25F2NOS3 — CID 121163817
1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-5-(dithiolan-3-yl)pentan-1-one (PubChem CID 121163817) has the molecular formula C19H25F2NOS3 and a molecular weight of 417.61 g/mol. Its IUPAC name is 1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-5-(dithiolan-3-yl)pentan-1-one.
| Compound Name | 1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-5-(dithiolan-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 121163817 |
| Molecular Formula | C19H25F2NOS3 |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 1-[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-5-(dithiolan-3-yl)pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C19H25F2NOS3/c20-14-5-6-17(21)16(13-14)18-7-9-22(10-12-24-18)19(23)4-2-1-3-15-8-11-25-26-15/h5-6,13,15,18H,1-4,7-12H2 |
| InChIKey | XSGPMVIZXQFEMU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|