C19H21FN2OS — CID 72720381
N-[(4-fluorophenyl)methyl]-7-phenyl-1,4-thiazepane-4-carboxamide (PubChem CID 72720381) has the molecular formula C19H21FN2OS and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-7-phenyl-1,4-thiazepane-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-7-phenyl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 72720381 |
| Molecular Formula | C19H21FN2OS |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-7-phenyl-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21FN2OS/c20-17-8-6-15(7-9-17)14-21-19(23)22-11-10-18(24-13-12-22)16-4-2-1-3-5-16/h1-9,18H,10-14H2,(H,21,23) |
| InChIKey | MQKNOSGIIUZYGW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |