C16H23FN2O3 — CID 91918293
N-[(4-fluorophenyl)methyl]-4-(2-methoxyethoxy)piperidine-1-carboxamide (PubChem CID 91918293) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-(2-methoxyethoxy)piperidine-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-(2-methoxyethoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91918293 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-(2-methoxyethoxy)piperidine-1-carboxamide |
| SMILES | COCCOC1CCN(C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O3/c1-21-10-11-22-15-6-8-19(9-7-15)16(20)18-12-13-2-4-14(17)5-3-13/h2-5,15H,6-12H2,1H3,(H,18,20) |
| InChIKey | FELZJXCJIGUBEY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|