C20H29FN4O3 — CID 113107632
ethyl 4-[4-[(4-fluorophenyl)methylcarbamoyl]piperazin-1-yl]piperidine-1-carboxylate (PubChem CID 113107632) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is ethyl 4-[4-[(4-fluorophenyl)methylcarbamoyl]piperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(4-fluorophenyl)methylcarbamoyl]piperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113107632 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | ethyl 4-[4-[(4-fluorophenyl)methylcarbamoyl]piperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCN(C(=O)NCc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H29FN4O3/c1-2-28-20(27)25-9-7-18(8-10-25)23-11-13-24(14-12-23)19(26)22-15-16-3-5-17(21)6-4-16/h3-6,18H,2,7-15H2,1H3,(H,22,26) |
| InChIKey | WLNXQEUAGKBMML-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |