C27H36N4O3 — CID 26335358
ethyl 4-[1-[4-[2-(benzylamino)-2-oxoethyl]phenyl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 26335358) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is ethyl 4-[1-[4-[2-(benzylamino)-2-oxoethyl]phenyl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-[4-[2-(benzylamino)-2-oxoethyl]phenyl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 26335358 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | ethyl 4-[1-[4-[2-(benzylamino)-2-oxoethyl]phenyl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCN(c3ccc(CC(=O)NCc4ccccc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H36N4O3/c1-2-34-27(33)31-18-16-30(17-19-31)25-12-14-29(15-13-25)24-10-8-22(9-11-24)20-26(32)28-21-23-6-4-3-5-7-23/h3-11,25H,2,12-21H2,1H3,(H,28,32) |
| InChIKey | DOXJYARSNQBZBI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|