C28H38N4O3 — CID 42425569
ethyl 4-[[1-[4-(3-phenylpropanoylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 42425569) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is ethyl 4-[[1-[4-(3-phenylpropanoylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[4-(3-phenylpropanoylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42425569 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | ethyl 4-[[1-[4-(3-phenylpropanoylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC2CCN(c3ccc(NC(=O)CCc4ccccc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H38N4O3/c1-2-35-28(34)32-20-16-25(17-21-32)29-24-14-18-31(19-15-24)26-11-9-23(10-12-26)30-27(33)13-8-22-6-4-3-5-7-22/h3-7,9-12,24-25,29H,2,8,13-21H2,1H3,(H,30,33) |
| InChIKey | KREOAHYQEVDQHO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|