C26H31N3OS — CID 26402333
3-phenyl-N-[4-[4-(2-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]propanamide (PubChem CID 26402333) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is 3-phenyl-N-[4-[4-(2-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]propanamide.
| Compound Name | 3-phenyl-N-[4-[4-(2-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 26402333 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-phenyl-N-[4-[4-(2-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(N2CCC(NCCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C26H31N3OS/c30-26(13-8-21-5-2-1-3-6-21)28-23-9-11-24(12-10-23)29-18-15-22(16-19-29)27-17-14-25-7-4-20-31-25/h1-7,9-12,20,22,27H,8,13-19H2,(H,28,30) |
| InChIKey | NIHPXDKBTHBWCF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|