C21H16N2O3S — CID 110635875
N-[4-(1,3-dioxoisoindol-2-yl)phenyl]-3-thiophen-2-ylpropanamide (PubChem CID 110635875) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)phenyl]-3-thiophen-2-ylpropanamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)phenyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 110635875 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)phenyl]-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CCc1cccs1)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H16N2O3S/c24-19(12-11-16-4-3-13-27-16)22-14-7-9-15(10-8-14)23-20(25)17-5-1-2-6-18(17)21(23)26/h1-10,13H,11-12H2,(H,22,24) |
| InChIKey | DATDAMBFMJQYKT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|