C24H19N3O6S — CID 2589988
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2589988) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2589988 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)NCc4cccs4)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H19N3O6S/c1-14(28)26-16-5-7-17(8-6-16)27-22(30)19-9-4-15(11-20(19)23(27)31)24(32)33-13-21(29)25-12-18-3-2-10-34-18/h2-11H,12-13H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | MGMWWMGEMLAOFS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|