C25H17N3O5S — CID 2486883
1,3-benzothiazol-2-ylmethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2486883) has the molecular formula C25H17N3O5S and a molecular weight of 471.49 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2486883 |
| Molecular Formula | C25H17N3O5S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)OCc4nc5ccccc5s4)cc3C2=O)cc1 |
| InChI | InChI=1S/C25H17N3O5S/c1-14(29)26-16-7-9-17(10-8-16)28-23(30)18-11-6-15(12-19(18)24(28)31)25(32)33-13-22-27-20-4-2-3-5-21(20)34-22/h2-12H,13H2,1H3,(H,26,29) |
| InChIKey | PSGKPPCVQNEXMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|