C26H27N3O6 — CID 55304941
[2-(cycloheptylamino)-2-oxoethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55304941) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55304941 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)NC4CCCCCC4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O6/c1-16(30)27-19-9-11-20(12-10-19)29-24(32)21-13-8-17(14-22(21)25(29)33)26(34)35-15-23(31)28-18-6-4-2-3-5-7-18/h8-14,18H,2-7,15H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | DONKMRIQSXXEKY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|