C19H16N2O5 — CID 24530050
ethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 24530050) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | ethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 24530050 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(=O)N(c1ccc(NC(C)=O)cc1)C2=O |
| InChI | InChI=1S/C19H16N2O5/c1-3-26-19(25)12-4-9-15-16(10-12)18(24)21(17(15)23)14-7-5-13(6-8-14)20-11(2)22/h4-10H,3H2,1-2H3,(H,20,22) |
| InChIKey | YHWYWMGFSMDFEM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|