C32H23NO7 — CID 23907240
[2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-ethoxycarbonylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 23907240) has the molecular formula C32H23NO7 and a molecular weight of 533.54 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-ethoxycarbonylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-ethoxycarbonylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 23907240 |
| Molecular Formula | C32H23NO7 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-ethoxycarbonylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4ccc(-c5ccccc5)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C32H23NO7/c1-2-39-31(37)23-12-15-25(16-13-23)33-29(35)26-17-14-24(18-27(26)30(33)36)32(38)40-19-28(34)22-10-8-21(9-11-22)20-6-4-3-5-7-20/h3-18H,2,19H2,1H3 |
| InChIKey | HCNHLBIOQKPRCS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|