C30H21NO6 — CID 1216905
[2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1216905) has the molecular formula C30H21NO6 and a molecular weight of 491.50 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1216905 |
| Molecular Formula | C30H21NO6 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4ccc(-c5ccccc5)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C30H21NO6/c1-36-24-14-12-23(13-15-24)31-28(33)25-16-11-22(17-26(25)29(31)34)30(35)37-18-27(32)21-9-7-20(8-10-21)19-5-3-2-4-6-19/h2-17H,18H2,1H3 |
| InChIKey | WZYVNTYWZZLAOE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|