C24H18N2O6 — CID 23987018
[2-(3-aminophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 23987018) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is [2-(3-aminophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-aminophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 23987018 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [2-(3-aminophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4cccc(N)c4)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H18N2O6/c1-31-18-8-6-17(7-9-18)26-22(28)19-10-5-15(12-20(19)23(26)29)24(30)32-13-21(27)14-3-2-4-16(25)11-14/h2-12H,13,25H2,1H3 |
| InChIKey | JQPBTVINYCCNKA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|