C26H19NO7 — CID 1216669
[2-(4-methoxyphenyl)-2-oxoethyl] 2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1216669) has the molecular formula C26H19NO7 and a molecular weight of 457.44 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1216669 |
| Molecular Formula | C26H19NO7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2cccc(C(C)=O)c2)C3=O)cc1 |
| InChI | InChI=1S/C26H19NO7/c1-15(28)17-4-3-5-19(12-17)27-24(30)21-11-8-18(13-22(21)25(27)31)26(32)34-14-23(29)16-6-9-20(33-2)10-7-16/h3-13H,14H2,1-2H3 |
| InChIKey | HHWJNSYWOYRAKU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|