C32H25NO7 — CID 3404740
[2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3404740) has the molecular formula C32H25NO7 and a molecular weight of 535.55 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3404740 |
| Molecular Formula | C32H25NO7 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(2,5-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Oc4cc(C)ccc4C)cc2)C3=O)c1 |
| InChI | InChI=1S/C32H25NO7/c1-19-7-8-20(2)29(15-19)40-24-12-10-23(11-13-24)33-30(35)26-14-9-22(17-27(26)31(33)36)32(37)39-18-28(34)21-5-4-6-25(16-21)38-3/h4-17H,18H2,1-3H3 |
| InChIKey | ZYNAYGINTLVVNJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|