C25H19NO7 — CID 1323928
[2-(3-methoxyphenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1323928) has the molecular formula C25H19NO7 and a molecular weight of 445.43 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1323928 |
| Molecular Formula | C25H19NO7 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2OC)C3=O)c1 |
| InChI | InChI=1S/C25H19NO7/c1-31-17-7-5-6-15(12-17)21(27)14-33-25(30)16-10-11-18-19(13-16)24(29)26(23(18)28)20-8-3-4-9-22(20)32-2/h3-13H,14H2,1-2H3 |
| InChIKey | VRZIFYZRAPVNSW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|