C25H19NO5 — CID 1332079
[2-(4-ethylphenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1332079) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1332079 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H19NO5/c1-2-16-7-9-17(10-8-16)22(27)15-31-25(30)18-11-13-19(14-12-18)26-23(28)20-5-3-4-6-21(20)24(26)29/h3-14H,2,15H2,1H3 |
| InChIKey | NBAHUYFAHBNJRM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|