C24H16ClN3O6 — CID 2527399
[2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2527399) has the molecular formula C24H16ClN3O6 and a molecular weight of 477.86 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2527399 |
| Molecular Formula | C24H16ClN3O6 |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Cl)cc2)C3=O)cc1 |
| InChI | InChI=1S/C24H16ClN3O6/c25-15-4-8-17(9-5-15)28-22(31)18-10-3-14(11-19(18)23(28)32)24(33)34-12-20(29)27-16-6-1-13(2-7-16)21(26)30/h1-11H,12H2,(H2,26,30)(H,27,29) |
| InChIKey | AUIXEUVVFVDKCZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|