C18H17NO4S — CID 2500972
1,3-benzothiazol-2-ylmethyl 4-ethoxy-3-methoxybenzoate (PubChem CID 2500972) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-ethoxy-3-methoxybenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 2500972 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C18H17NO4S/c1-3-22-14-9-8-12(10-15(14)21-2)18(20)23-11-17-19-13-6-4-5-7-16(13)24-17/h4-10H,3,11H2,1-2H3 |
| InChIKey | FIEWBLXYFIXSNH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |