C24H20N2O5S — CID 42967216
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42967216) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42967216 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)OCC(=O)NCc4cccs4)cc3C2=O)c1 |
| InChI | InChI=1S/C24H20N2O5S/c1-14-5-6-15(2)20(10-14)26-22(28)18-8-7-16(11-19(18)23(26)29)24(30)31-13-21(27)25-12-17-4-3-9-32-17/h3-11H,12-13H2,1-2H3,(H,25,27) |
| InChIKey | UTSARFXRGNHPNT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|