C27H24N2O5 — CID 4857890
[2-(3,5-dimethylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4857890) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4857890 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(C)cc(NC(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)ccc2C)C3=O)c1 |
| InChI | InChI=1S/C27H24N2O5/c1-15-5-6-18(4)23(12-15)29-25(31)21-8-7-19(13-22(21)26(29)32)27(33)34-14-24(30)28-20-10-16(2)9-17(3)11-20/h5-13H,14H2,1-4H3,(H,28,30) |
| InChIKey | HOTBHJURUCYELN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|