C26H20F2N2O6 — CID 42967215
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42967215) has the molecular formula C26H20F2N2O6 and a molecular weight of 494.45 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42967215 |
| Molecular Formula | C26H20F2N2O6 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)OCC(=O)Nc4ccccc4OC(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C26H20F2N2O6/c1-14-7-8-15(2)20(11-14)30-23(32)17-10-9-16(12-18(17)24(30)33)25(34)35-13-22(31)29-19-5-3-4-6-21(19)36-26(27)28/h3-12,26H,13H2,1-2H3,(H,29,31) |
| InChIKey | UKWBSRBADUVQNM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|