C14H14N2O2S — CID 8571859
4-(3-thiophen-2-ylpropanoylamino)benzamide (PubChem CID 8571859) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-(3-thiophen-2-ylpropanoylamino)benzamide.
| Compound Name | 4-(3-thiophen-2-ylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 8571859 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-(3-thiophen-2-ylpropanoylamino)benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCc2cccs2)cc1 |
| InChI | InChI=1S/C14H14N2O2S/c15-14(18)10-3-5-11(6-4-10)16-13(17)8-7-12-2-1-9-19-12/h1-6,9H,7-8H2,(H2,15,18)(H,16,17) |
| InChIKey | AFEMBLDDFROWMM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |