C19H20N3O3S+ — CID 8677797
[2-(4-carbamoylanilino)-2-oxoethyl]-(furan-2-ylmethyl)-(thiophen-2-ylmethyl)azanium (PubChem CID 8677797) has the molecular formula C19H20N3O3S+ and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-(furan-2-ylmethyl)-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-(furan-2-ylmethyl)-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8677797 |
| Molecular Formula | C19H20N3O3S+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-(furan-2-ylmethyl)-(thiophen-2-ylmethyl)azanium |
| SMILES | NC(=O)c1ccc(NC(=O)C[NH+](Cc2ccco2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H19N3O3S/c20-19(24)14-5-7-15(8-6-14)21-18(23)13-22(11-16-3-1-9-25-16)12-17-4-2-10-26-17/h1-10H,11-13H2,(H2,20,24)(H,21,23)/p+1 |
| InChIKey | PWKDQMSVLMLLQA-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |