C22H21N2O2S+ — CID 8677699
furan-2-ylmethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 8677699) has the molecular formula C22H21N2O2S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is furan-2-ylmethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | furan-2-ylmethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8677699 |
| Molecular Formula | C22H21N2O2S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | furan-2-ylmethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | O=C(C[NH+](Cc1ccco1)Cc1cccs1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H20N2O2S/c25-22(23-21-11-3-7-17-6-1-2-10-20(17)21)16-24(14-18-8-4-12-26-18)15-19-9-5-13-27-19/h1-13H,14-16H2,(H,23,25)/p+1 |
| InChIKey | JIIFMOJJQKKARO-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |