C18H16Cl3N2O3+ — CID 8840703
bis(furan-2-ylmethyl)-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium (PubChem CID 8840703) has the molecular formula C18H16Cl3N2O3+ and a molecular weight of 414.70 g/mol. Its IUPAC name is bis(furan-2-ylmethyl)-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium.
| Compound Name | bis(furan-2-ylmethyl)-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8840703 |
| Molecular Formula | C18H16Cl3N2O3+ |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | bis(furan-2-ylmethyl)-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccco1)Cc1ccco1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3N2O3/c19-14-7-16(21)17(8-15(14)20)22-18(24)11-23(9-12-3-1-5-25-12)10-13-4-2-6-26-13/h1-8H,9-11H2,(H,22,24)/p+1 |
| InChIKey | PKCUNKCKAAPTPV-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 59.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|