C17H24N3O4+ — CID 8841411
[2-(tert-butylcarbamoylamino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium (PubChem CID 8841411) has the molecular formula C17H24N3O4+ and a molecular weight of 334.40 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8841411 |
| Molecular Formula | C17H24N3O4+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
| SMILES | CC(C)(C)NC(=O)NC(=O)C[NH+](Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C17H23N3O4/c1-17(2,3)19-16(22)18-15(21)12-20(10-13-6-4-8-23-13)11-14-7-5-9-24-14/h4-9H,10-12H2,1-3H3,(H2,18,19,21,22)/p+1 |
| InChIKey | XWURJMGSXUYYAE-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |