C18H17F2N2O3+ — CID 8841313
[2-(2,5-difluoroanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium (PubChem CID 8841313) has the molecular formula C18H17F2N2O3+ and a molecular weight of 347.34 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8841313 |
| Molecular Formula | C18H17F2N2O3+ |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
| SMILES | O=C(C[NH+](Cc1ccco1)Cc1ccco1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H16F2N2O3/c19-13-5-6-16(20)17(9-13)21-18(23)12-22(10-14-3-1-7-24-14)11-15-4-2-8-25-15/h1-9H,10-12H2,(H,21,23)/p+1 |
| InChIKey | LHAVUUVWKXGWMX-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 59.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |