C20H23N2O4+ — CID 8841127
[2-(4-ethoxyanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium (PubChem CID 8841127) has the molecular formula C20H23N2O4+ and a molecular weight of 355.41 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8841127 |
| Molecular Formula | C20H23N2O4+ |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
| SMILES | CCOc1ccc(NC(=O)C[NH+](Cc2ccco2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-2-24-17-9-7-16(8-10-17)21-20(23)15-22(13-18-5-3-11-25-18)14-19-6-4-12-26-19/h3-12H,2,13-15H2,1H3,(H,21,23)/p+1 |
| InChIKey | JEKCGVFMSWIFGJ-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 69.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |