C21H22N2O5 — CID 6970033
(1R,2R,3S,4S)-3-N-(4-ethoxyphenyl)-2-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 6970033) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-N-(4-ethoxyphenyl)-2-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1R,2R,3S,4S)-3-N-(4-ethoxyphenyl)-2-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 6970033 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (1R,2R,3S,4S)-3-N-(4-ethoxyphenyl)-2-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@@H](C(=O)NCc3ccco3)[C@H]3C=C[C@@H]2O3)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-2-26-14-7-5-13(6-8-14)23-21(25)19-17-10-9-16(28-17)18(19)20(24)22-12-15-4-3-11-27-15/h3-11,16-19H,2,12H2,1H3,(H,22,24)(H,23,25)/t16-,17+,18+,19-/m1/s1 |
| InChIKey | VZVYDTIWJFJFBH-YDZRNGNQSA-N |
| XLogP | 2.50 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|