C12H15ClN2O3 — CID 154923078
(1R,2S,3R,4S)-3-amino-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride (PubChem CID 154923078) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-amino-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride.
| Compound Name | (1R,2S,3R,4S)-3-amino-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154923078 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (1R,2S,3R,4S)-3-amino-N-(furan-2-ylmethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride |
| SMILES | Cl.N[C@@H]1[C@H](C(=O)NCc2ccco2)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C12H14N2O3.ClH/c13-11-9-4-3-8(17-9)10(11)12(15)14-6-7-2-1-5-16-7;/h1-5,8-11H,6,13H2,(H,14,15);1H/t8-,9+,10-,11+;/m1./s1 |
| InChIKey | RMXIKPSBYCVRNV-RTBBDAMFSA-N |
| XLogP | 0.60 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|