C13H13NO3 — CID 711236
N-(4-ethoxyphenyl)furan-2-carboxamide (PubChem CID 711236) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)furan-2-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 711236 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-(4-ethoxyphenyl)furan-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C13H13NO3/c1-2-16-11-7-5-10(6-8-11)14-13(15)12-4-3-9-17-12/h3-9H,2H2,1H3,(H,14,15) |
| InChIKey | QHQMTIZGRHMXQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |