C14H18N2O5 — CID 3490448
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 3490448) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3490448 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C14H18N2O5/c1-14(2,3)16-13(19)15-11(17)9-21-12(18)7-6-10-5-4-8-20-10/h4-8H,9H2,1-3H3,(H2,15,16,17,19) |
| InChIKey | KYXBHMZQCBZUPI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|