C13H17NO4 — CID 2429932
[2-(butylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2429932) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2429932 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CCCCNC(=O)COC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C13H17NO4/c1-2-3-8-14-12(15)10-18-13(16)7-6-11-5-4-9-17-11/h4-7,9H,2-3,8,10H2,1H3,(H,14,15)/b7-6+ |
| InChIKey | FNORFCZZPRYYHA-VOTSOKGWSA-N |
| XLogP | 1.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|