C12H14N2O5 — CID 5151438
[2-(ethylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 5151438) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5151438 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C12H14N2O5/c1-2-13-12(17)14-10(15)8-19-11(16)6-5-9-4-3-7-18-9/h3-7H,2,8H2,1H3,(H2,13,14,15,17) |
| InChIKey | VWABZDOXNOVDMW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|