C17H16FNO4 — CID 9010151
[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 9010151) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9010151 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccco1)NCCc1ccccc1F |
| InChI | InChI=1S/C17H16FNO4/c18-15-6-2-1-4-13(15)9-10-19-16(20)12-23-17(21)8-7-14-5-3-11-22-14/h1-8,11H,9-10,12H2,(H,19,20)/b8-7+ |
| InChIKey | URASWZQOJGAKLA-BQYQJAHWSA-N |
| XLogP | 2.33 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|