C19H21N2OS2+ — CID 8800780
[2-(4-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium (PubChem CID 8800780) has the molecular formula C19H21N2OS2+ and a molecular weight of 357.52 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8800780 |
| Molecular Formula | C19H21N2OS2+ |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](Cc2cccs2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H20N2OS2/c1-15-6-8-16(9-7-15)20-19(22)14-21(12-17-4-2-10-23-17)13-18-5-3-11-24-18/h2-11H,12-14H2,1H3,(H,20,22)/p+1 |
| InChIKey | MVGJQPWNZYNZLV-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |