C19H20ClN2OS2+ — CID 8800767
[2-(5-chloro-2-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium (PubChem CID 8800767) has the molecular formula C19H20ClN2OS2+ and a molecular weight of 391.97 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8800767 |
| Molecular Formula | C19H20ClN2OS2+ |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C[NH+](Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C19H19ClN2OS2/c1-14-6-7-15(20)10-18(14)21-19(23)13-22(11-16-4-2-8-24-16)12-17-5-3-9-25-17/h2-10H,11-13H2,1H3,(H,21,23)/p+1 |
| InChIKey | APPYZKHUULFLEY-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |