C16H20FN2OS+ — CID 8718326
ethyl-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 8718326) has the molecular formula C16H20FN2OS+ and a molecular weight of 307.41 g/mol. Its IUPAC name is ethyl-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | ethyl-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8718326 |
| Molecular Formula | C16H20FN2OS+ |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | ethyl-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(C)cc1F)Cc1cccs1 |
| InChI | InChI=1S/C16H19FN2OS/c1-3-19(10-13-5-4-8-21-13)11-16(20)18-15-7-6-12(2)9-14(15)17/h4-9H,3,10-11H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | DZGOGWYPEBPIPQ-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |